C23H15N6NaO7S — CID 53326684
sodium 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonate (PubChem CID 53326684) has the molecular formula C23H15N6NaO7S and a molecular weight of 542.47 g/mol. Its IUPAC name is sodium 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | sodium 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 53326684 |
| Molecular Formula | C23H15N6NaO7S |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | sodium 1-amino-4-[4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2ccc(Nc3nc(=O)[nH]c(=O)[nH]3)cc2)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| InChI | InChI=1S/C23H16N6O7S.Na/c24-18-15(37(34,35)36)9-14(16-17(18)20(31)13-4-2-1-3-12(13)19(16)30)25-10-5-7-11(8-6-10)26-21-27-22(32)29-23(33)28-21;/h1-9,25H,24H2,(H,34,35,36)(H3,26,27,28,29,32,33);/q;+1/p-1 |
| InChIKey | GJMBLLXANUDGDH-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 220.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|