C24H32F6N4O4 — CID 53326721
[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(2,2,2-trifluoro-1-hydroxyethyl)cyclopentyl]-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 53326721) has the molecular formula C24H32F6N4O4 and a molecular weight of 554.53 g/mol. Its IUPAC name is [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(2,2,2-trifluoro-1-hydroxyethyl)cyclopentyl]-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(2,2,2-trifluoro-1-hydroxyethyl)cyclopentyl]-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53326721 |
| Molecular Formula | C24H32F6N4O4 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(2,2,2-trifluoro-1-hydroxyethyl)cyclopentyl]-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | CO[C@@H]1COCC[C@@H]1N[C@@H]1CC[C@@](C(=O)N2CCN(c3cc(C(F)(F)F)ccn3)CC2)(C(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C24H32F6N4O4/c1-37-18-14-38-11-4-17(18)32-16-2-5-22(13-16,20(35)24(28,29)30)21(36)34-9-7-33(8-10-34)19-12-15(3-6-31-19)23(25,26)27/h3,6,12,16-18,20,32,35H,2,4-5,7-11,13-14H2,1H3/t16-,17+,18-,20?,22+/m1/s1 |
| InChIKey | UZRULJNSSUAOBU-UUCWOBOSSA-N |
| XLogP | 2.60 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |