C29H40O4 — CID 53326740
3-hydroxy-5-(3-methylbutoxy)-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one (PubChem CID 53326740) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-hydroxy-5-(3-methylbutoxy)-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-5-(3-methylbutoxy)-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 53326740 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 3-hydroxy-5-(3-methylbutoxy)-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
| SMILES | CCCC1=C(OCCC(C)C)C(CCC)(CCC)C(=O)C(C(=O)/C=C/c2ccccc2)=C1O |
| InChI | InChI=1S/C29H40O4/c1-6-12-23-26(31)25(24(30)16-15-22-13-10-9-11-14-22)27(32)29(18-7-2,19-8-3)28(23)33-20-17-21(4)5/h9-11,13-16,21,31H,6-8,12,17-20H2,1-5H3/b16-15+ |
| InChIKey | DLIZUMIMULYANW-FOCLMDBBSA-N |
| XLogP | 7.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|