About [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate
[(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate (PubChem CID 5332683) has the molecular formula C14H11ClN2O2
and a molecular weight of 274.71 g/mol. Its IUPAC name is [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate |
| PubChem CID | 5332683 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate |
| SMILES | N/C(=N\OC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11ClN2O2/c15-12-9-5-4-8-11(12)14(18)19-17-13(16)10-6-2-1-3-7-10/h1-9H,(H2,16,17) |
| InChIKey | ATXRRRCIHZTEEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate?
The IUPAC name of [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate (CID 5332683) is [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate.
What is the SMILES notation for [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate?
The canonical SMILES for [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate is N/C(=N\OC(=O)c1ccccc1Cl)c1ccccc1.
What is the InChIKey of [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate?
The InChIKey is ATXRRRCIHZTEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O2/c15-12-9-5-4-8-11(12)14(18)19-17-13(16)10-6-2-1-3-7-10/h1-9H,(H2,16,17).
What are the key properties of [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate?
[(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate has a molecular weight of 274.71 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino(phenyl)methylidene]amino] 2-chlorobenzoate is sourced from PubChem (CID 5332683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).