About 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile
4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile (PubChem CID 53326831) has the molecular formula C16H9N3S
and a molecular weight of 275.34 g/mol. Its IUPAC name is 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile.
Molecular Properties
| Compound Name | 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile |
| PubChem CID | 53326831 |
| Molecular Formula | C16H9N3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile |
| SMILES | N#Cc1ccc(-c2cn3c(n2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C16H9N3S/c17-9-11-5-7-12(8-6-11)13-10-19-14-3-1-2-4-15(14)20-16(19)18-13/h1-8,10H |
| InChIKey | WDFOFMVFXHPWRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile?
The IUPAC name of 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile (CID 53326831) is 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile.
What is the SMILES notation for 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile?
The canonical SMILES for 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile is N#Cc1ccc(-c2cn3c(n2)sc2ccccc23)cc1.
What is the InChIKey of 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile?
The InChIKey is WDFOFMVFXHPWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3S/c17-9-11-5-7-12(8-6-11)13-10-19-14-3-1-2-4-15(14)20-16(19)18-13/h1-8,10H.
What are the key properties of 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile?
4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile has a molecular weight of 275.34 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[2,1-b][1,3]benzothiazol-2-ylbenzonitrile is sourced from PubChem (CID 53326831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).