C23H33FO3 — CID 53326924
(8S,9S,11S,13S,14S,17S)-11-[3-(2-fluoroethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53326924) has the molecular formula C23H33FO3 and a molecular weight of 376.51 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11-[3-(2-fluoroethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11-[3-(2-fluoroethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53326924 |
| Molecular Formula | C23H33FO3 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11-[3-(2-fluoroethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](CCCOCCF)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C23H33FO3/c1-23-14-16(3-2-11-27-12-10-24)22-18-7-5-17(25)13-15(18)4-6-19(22)20(23)8-9-21(23)26/h5,7,13,16,19-22,25-26H,2-4,6,8-12,14H2,1H3/t16-,19-,20-,21-,22+,23-/m0/s1 |
| InChIKey | QDQIJIRAHOMIEE-CLWFVZRMSA-N |
| XLogP | 4.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|