C23H25NO6S — CID 53326940
(2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53326940) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53326940 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H25NO6S/c25-11-17-20(26)21(27)22(28)23(30-17)13-5-6-15(12-3-4-12)14(8-13)9-19-24-10-18(31-19)16-2-1-7-29-16/h1-2,5-8,10,12,17,20-23,25-28H,3-4,9,11H2/t17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | ACAUEKMPUFWNLM-PHNZBSFLSA-N |
| XLogP | 2.39 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |