C30H36N6O5S — CID 53327176
3-amino-6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide;4-methylbenzenesulfonic acid (PubChem CID 53327176) has the molecular formula C30H36N6O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is 3-amino-6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide;4-methylbenzenesulfonic acid.
| Compound Name | 3-amino-6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 53327176 |
| Molecular Formula | C30H36N6O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 3-amino-6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide;4-methylbenzenesulfonic acid |
| SMILES | COCCCNCCCc1ccc(-c2cnc(N)c(C(=O)Nc3cccnc3)n2)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H28N6O2.C7H8O3S/c1-31-14-4-13-25-11-2-5-17-7-9-18(10-8-17)20-16-27-22(24)21(29-20)23(30)28-19-6-3-12-26-15-19;1-6-2-4-7(5-3-6)11(8,9)10/h3,6-10,12,15-16,25H,2,4-5,11,13-14H2,1H3,(H2,24,27)(H,28,30);2-5H,1H3,(H,8,9,10) |
| InChIKey | LEGFUMPJHBPONX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|