C18H19FN2O5 — CID 53327252
5-[(4-fluorophenyl)-hydroxymethyl]-N-hydroxy-N,2,2-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide (PubChem CID 53327252) has the molecular formula C18H19FN2O5 and a molecular weight of 362.36 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)-hydroxymethyl]-N-hydroxy-N,2,2-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)-hydroxymethyl]-N-hydroxy-N,2,2-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 53327252 |
| Molecular Formula | C18H19FN2O5 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-[(4-fluorophenyl)-hydroxymethyl]-N-hydroxy-N,2,2-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide |
| SMILES | CN(O)C(=O)c1ncc(C(O)c2ccc(F)cc2)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C18H19FN2O5/c1-18(2)25-9-13-12(15(22)10-4-6-11(19)7-5-10)8-20-14(16(13)26-18)17(23)21(3)24/h4-8,15,22,24H,9H2,1-3H3 |
| InChIKey | HHFSQDCKCIKLAL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|