C26H25N3 — CID 53327262
5-[(3-phenylphenyl)methyl]-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene (PubChem CID 53327262) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is 5-[(3-phenylphenyl)methyl]-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene.
| Compound Name | 5-[(3-phenylphenyl)methyl]-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
|---|---|
| PubChem CID | 53327262 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 5-[(3-phenylphenyl)methyl]-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
| SMILES | c1ccc(-c2cccc(CN3CCN4c5cccc6[nH]cc(c56)CC4C3)c2)cc1 |
| InChI | InChI=1S/C26H25N3/c1-2-7-20(8-3-1)21-9-4-6-19(14-21)17-28-12-13-29-23(18-28)15-22-16-27-24-10-5-11-25(29)26(22)24/h1-11,14,16,23,27H,12-13,15,17-18H2 |
| InChIKey | YMYDUVXFUAIERG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |