C31H48N8O3 — CID 53327799
(2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]hexanamide (PubChem CID 53327799) has the molecular formula C31H48N8O3 and a molecular weight of 580.78 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 53327799 |
| Molecular Formula | C31H48N8O3 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C31H48N8O3/c32-18-6-4-12-26(29(41)36-20-8-9-21-37-31(34)35)39-30(42)27(13-5-7-19-33)38-28(40)22-23-14-16-25(17-15-23)24-10-2-1-3-11-24/h1-3,10-11,14-17,26-27H,4-9,12-13,18-22,32-33H2,(H,36,41)(H,38,40)(H,39,42)(H4,34,35,37)/t26-,27-/m0/s1 |
| InChIKey | FEULFDOAGOQVKM-SVBPBHIXSA-N |
| XLogP | 1.29 |
| TPSA | 203.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|