C23H24ClNO6S2 — CID 53327912
(2S,3R,4R,5S,6R)-2-[4-chloro-2-prop-2-enoxy-5-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53327912) has the molecular formula C23H24ClNO6S2 and a molecular weight of 510.03 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-2-prop-2-enoxy-5-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-prop-2-enoxy-5-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53327912 |
| Molecular Formula | C23H24ClNO6S2 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-prop-2-enoxy-5-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CCOc1cc(Cl)c(Cc2ncc(-c3ccsc3)s2)cc1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H24ClNO6S2/c1-2-4-30-16-8-15(24)13(7-19-25-9-18(33-19)12-3-5-32-11-12)6-14(16)23-22(29)21(28)20(27)17(10-26)31-23/h2-3,5-6,8-9,11,17,20-23,26-29H,1,4,7,10H2/t17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | BANZPYOVDNRGMY-PHNZBSFLSA-N |
| XLogP | 3.20 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|