C15H10F3NO4S — CID 53327934
2-[(5Z)-2,4-dioxo-5-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 53327934) has the molecular formula C15H10F3NO4S and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 53327934 |
| Molecular Formula | C15H10F3NO4S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C\C=C\c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C15H10F3NO4S/c16-15(17,18)10-6-4-9(5-7-10)2-1-3-11-13(22)19(8-12(20)21)14(23)24-11/h1-7H,8H2,(H,20,21)/b2-1+,11-3- |
| InChIKey | DQLWNOQVOPSJGI-YUTSCENRSA-N |
| XLogP | 3.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|