C15H12IN3 — CID 53327940
13-methyl-1,11-diaza-13-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12(17),13,15-octaene iodide (PubChem CID 53327940) has the molecular formula C15H12IN3 and a molecular weight of 361.19 g/mol. Its IUPAC name is 13-methyl-1,11-diaza-13-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12(17),13,15-octaene iodide.
| Compound Name | 13-methyl-1,11-diaza-13-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12(17),13,15-octaene iodide |
|---|---|
| PubChem CID | 53327940 |
| Molecular Formula | C15H12IN3 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 13-methyl-1,11-diaza-13-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12(17),13,15-octaene iodide |
| SMILES | C[n+]1cccc2c1nc1ccc3ccccc3n12.[I-] |
| InChI | InChI=1S/C15H12N3.HI/c1-17-10-4-7-13-15(17)16-14-9-8-11-5-2-3-6-12(11)18(13)14;/h2-10H,1H3;1H/q+1;/p-1 |
| InChIKey | FTCPLNCNTPPZPO-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|