C20H21N3O3S — CID 53327999
11-(2-methoxyphenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene (PubChem CID 53327999) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 11-(2-methoxyphenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene.
| Compound Name | 11-(2-methoxyphenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
|---|---|
| PubChem CID | 53327999 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 11-(2-methoxyphenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
| SMILES | COc1ccccc1S(=O)(=O)n1cc2c3c(cccc31)N1CCNCC1C2 |
| InChI | InChI=1S/C20H21N3O3S/c1-26-18-7-2-3-8-19(18)27(24,25)23-13-14-11-15-12-21-9-10-22(15)16-5-4-6-17(23)20(14)16/h2-8,13,15,21H,9-12H2,1H3 |
| InChIKey | NWDBPARGLORFCM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |