C18H20O7S — CID 53328323
[4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl methanesulfonate (PubChem CID 53328323) has the molecular formula C18H20O7S and a molecular weight of 380.42 g/mol. Its IUPAC name is [4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 53328323 |
| Molecular Formula | C18H20O7S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl methanesulfonate |
| SMILES | CCc1ccc(C2OOC(c3ccc(COS(C)(=O)=O)cc3)OO2)cc1 |
| InChI | InChI=1S/C18H20O7S/c1-3-13-4-8-15(9-5-13)17-22-24-18(25-23-17)16-10-6-14(7-11-16)12-21-26(2,19)20/h4-11,17-18H,3,12H2,1-2H3 |
| InChIKey | URIKBTOPBYYUQM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|