C21H23ClN4O2S — CID 53328359
N-[3-acetyl-2-(2-chloro-8-methylquinolin-3-yl)-2H-1,3,4-thiadiazol-5-yl]-N-cyclopentylacetamide (PubChem CID 53328359) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is N-[3-acetyl-2-(2-chloro-8-methylquinolin-3-yl)-2H-1,3,4-thiadiazol-5-yl]-N-cyclopentylacetamide.
| Compound Name | N-[3-acetyl-2-(2-chloro-8-methylquinolin-3-yl)-2H-1,3,4-thiadiazol-5-yl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 53328359 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-acetyl-2-(2-chloro-8-methylquinolin-3-yl)-2H-1,3,4-thiadiazol-5-yl]-N-cyclopentylacetamide |
| SMILES | CC(=O)N1N=C(N(C(C)=O)C2CCCC2)SC1c1cc2cccc(C)c2nc1Cl |
| InChI | InChI=1S/C21H23ClN4O2S/c1-12-7-6-8-15-11-17(19(22)23-18(12)15)20-26(14(3)28)24-21(29-20)25(13(2)27)16-9-4-5-10-16/h6-8,11,16,20H,4-5,9-10H2,1-3H3 |
| InChIKey | PGXSZMLRGZZGFE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|