C25H42O3 — CID 53328653
(1S,6S,9R,13R,14E,17S,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one (PubChem CID 53328653) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is (1S,6S,9R,13R,14E,17S,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one.
| Compound Name | (1S,6S,9R,13R,14E,17S,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one |
|---|---|
| PubChem CID | 53328653 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (1S,6S,9R,13R,14E,17S,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@@H](C/C=C/[C@H](C)C1)C[C@@H]2C |
| InChI | InChI=1S/C25H42O3/c1-6-10-22-16-19(3)15-18(2)11-9-13-23-17-21(5)24(27-23)14-8-7-12-20(4)25(26)28-22/h9,11,18,20-24H,3,6-8,10,12-17H2,1-2,4-5H3/b11-9+/t18-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | DVYZZUFKZJEAPJ-LIOHVDCRSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|