C18H18O5 — CID 53328724
(12S,17S)-15-ethoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione (PubChem CID 53328724) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (12S,17S)-15-ethoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione.
| Compound Name | (12S,17S)-15-ethoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione |
|---|---|
| PubChem CID | 53328724 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (12S,17S)-15-ethoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione |
| SMILES | CCOC1CC[C@H]2CC3=C(O[C@H]2O1)c1ccccc1C(=O)C3=O |
| InChI | InChI=1S/C18H18O5/c1-2-21-14-8-7-10-9-13-16(20)15(19)11-5-3-4-6-12(11)17(13)23-18(10)22-14/h3-6,10,14,18H,2,7-9H2,1H3/t10-,14?,18+/m0/s1 |
| InChIKey | FOIXFFCXNKFBPS-MCEQOLEDSA-N |
| XLogP | 2.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|