C17H16O5 — CID 53328725
(12S,17S)-15-methoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione (PubChem CID 53328725) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is (12S,17S)-15-methoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione.
| Compound Name | (12S,17S)-15-methoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione |
|---|---|
| PubChem CID | 53328725 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (12S,17S)-15-methoxy-16,18-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6-tetraene-8,9-dione |
| SMILES | COC1CC[C@H]2CC3=C(O[C@H]2O1)c1ccccc1C(=O)C3=O |
| InChI | InChI=1S/C17H16O5/c1-20-13-7-6-9-8-12-15(19)14(18)10-4-2-3-5-11(10)16(12)22-17(9)21-13/h2-5,9,13,17H,6-8H2,1H3/t9-,13?,17+/m0/s1 |
| InChIKey | XMKUGXAKXMFOJS-OJGLRQOPSA-N |
| XLogP | 2.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|