C21H22ClNO7S — CID 53328864
(2S,3R,4R,5S,6R)-2-[4-chloro-5-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-(hydroxymethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53328864) has the molecular formula C21H22ClNO7S and a molecular weight of 467.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-(hydroxymethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-(hydroxymethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53328864 |
| Molecular Formula | C21H22ClNO7S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-(hydroxymethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCc1cc(Cl)c(Cc2ncc(-c3ccco3)s2)cc1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22ClNO7S/c22-13-5-11(8-24)12(21-20(28)19(27)18(26)15(9-25)30-21)4-10(13)6-17-23-7-16(31-17)14-2-1-3-29-14/h1-5,7,15,18-21,24-28H,6,8-9H2/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | ILPZCMUWEGFESX-GRARQNNCSA-N |
| XLogP | 1.65 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |