C14H30O2Si — CID 53329007
(3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhept-1-en-4-ol (PubChem CID 53329007) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhept-1-en-4-ol.
| Compound Name | (3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 53329007 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhept-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@H](O)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-11(2)13(15)10-12(3)16-17(7,8)14(4,5)6/h9,11-13,15H,1,10H2,2-8H3/t11-,12-,13-/m1/s1 |
| InChIKey | FLHMXIJWUBADFI-JHJVBQTASA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|