C17H34O3Si — CID 53329014
(1S,2R)-1-ethyl-5-tri(propan-2-yl)silyloxycyclohex-4-ene-1,2-diol (PubChem CID 53329014) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (1S,2R)-1-ethyl-5-tri(propan-2-yl)silyloxycyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2R)-1-ethyl-5-tri(propan-2-yl)silyloxycyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 53329014 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (1S,2R)-1-ethyl-5-tri(propan-2-yl)silyloxycyclohex-4-ene-1,2-diol |
| SMILES | CC[C@]1(O)CC(O[Si](C(C)C)(C(C)C)C(C)C)=CC[C@H]1O |
| InChI | InChI=1S/C17H34O3Si/c1-8-17(19)11-15(9-10-16(17)18)20-21(12(2)3,13(4)5)14(6)7/h9,12-14,16,18-19H,8,10-11H2,1-7H3/t16-,17+/m1/s1 |
| InChIKey | GVMNAKVFFYVPAL-SJORKVTESA-N |
| XLogP | 4.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|