C23H28NO4PS — CID 53329153
N-(10-dimethylphosphanyl-1,2,3-trimethoxy-9-sulfanylidene-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide (PubChem CID 53329153) has the molecular formula C23H28NO4PS and a molecular weight of 445.52 g/mol. Its IUPAC name is N-(10-dimethylphosphanyl-1,2,3-trimethoxy-9-sulfanylidene-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide.
| Compound Name | N-(10-dimethylphosphanyl-1,2,3-trimethoxy-9-sulfanylidene-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
|---|---|
| PubChem CID | 53329153 |
| Molecular Formula | C23H28NO4PS |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-(10-dimethylphosphanyl-1,2,3-trimethoxy-9-sulfanylidene-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(P(C)C)c(=S)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C23H28NO4PS/c1-13(25)24-17-9-7-14-11-18(26-2)22(27-3)23(28-4)21(14)15-8-10-19(29(5)6)20(30)12-16(15)17/h8,10-12,17H,7,9H2,1-6H3,(H,24,25) |
| InChIKey | KQJQIDGVABKACL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|