C22H47BrO2Si2 — CID 53329189
[(E,2R,4R,5R)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyloct-6-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53329189) has the molecular formula C22H47BrO2Si2 and a molecular weight of 479.69 g/mol. Its IUPAC name is [(E,2R,4R,5R)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyloct-6-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R,4R,5R)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyloct-6-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53329189 |
| Molecular Formula | C22H47BrO2Si2 |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [(E,2R,4R,5R)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyloct-6-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\[C@@H](C)[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CBr |
| InChI | InChI=1S/C22H47BrO2Si2/c1-17(16-23)14-18(2)20(25-27(12,13)22(7,8)9)15-19(3)24-26(10,11)21(4,5)6/h14,18-20H,15-16H2,1-13H3/b17-14+/t18-,19-,20-/m1/s1 |
| InChIKey | VLIJWIKOJSUGAF-PGLMLKKXSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|