C29H28ClN3O5 — CID 53329246
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]benzamide (PubChem CID 53329246) has the molecular formula C29H28ClN3O5 and a molecular weight of 534.01 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]benzamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]benzamide |
|---|---|
| PubChem CID | 53329246 |
| Molecular Formula | C29H28ClN3O5 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-[6-(4-ethylphenyl)-1,2,4,5-tetraoxan-3-yl]benzamide |
| SMILES | CCc1ccc(C2OOC(c3ccc(C(=O)NCCCNc4ccnc5cc(Cl)ccc45)cc3)OO2)cc1 |
| InChI | InChI=1S/C29H28ClN3O5/c1-2-19-4-6-21(7-5-19)28-35-37-29(38-36-28)22-10-8-20(9-11-22)27(34)33-16-3-15-31-25-14-17-32-26-18-23(30)12-13-24(25)26/h4-14,17-18,28-29H,2-3,15-16H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | KHMPNKLWSMUQJG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|