C17H18N2O2 — CID 53329383
methyl (2S,4S,7R)-4-methyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-6-carboxylate (PubChem CID 53329383) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (2S,4S,7R)-4-methyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-6-carboxylate.
| Compound Name | methyl (2S,4S,7R)-4-methyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 53329383 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl (2S,4S,7R)-4-methyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-6-carboxylate |
| SMILES | COC(=O)N1C[C@@]2(C)C[C@]23c2cccc4[nH]cc(c24)C[C@@H]13 |
| InChI | InChI=1S/C17H18N2O2/c1-16-8-17(16)11-4-3-5-12-14(11)10(7-18-12)6-13(17)19(9-16)15(20)21-2/h3-5,7,13,18H,6,8-9H2,1-2H3/t13-,16-,17-/m1/s1 |
| InChIKey | KSXHBODABYPVMQ-KBRIMQKVSA-N |
| XLogP | 2.82 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |