C18H27BrN2 — CID 53329776
2-[(4-tert-butylphenyl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide (PubChem CID 53329776) has the molecular formula C18H27BrN2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide |
|---|---|
| PubChem CID | 53329776 |
| Molecular Formula | C18H27BrN2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide |
| SMILES | CC(C)(C)c1ccc(C[N+]2=CN3CCCCC3C2)cc1.[Br-] |
| InChI | InChI=1S/C18H27N2.BrH/c1-18(2,3)16-9-7-15(8-10-16)12-19-13-17-6-4-5-11-20(17)14-19;/h7-10,14,17H,4-6,11-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ANKHGRAXSSVXRQ-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|