C21H14F3NO4S — CID 53329937
2-[(5Z)-2,4-dioxo-5-[[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 53329937) has the molecular formula C21H14F3NO4S and a molecular weight of 433.41 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 53329937 |
| Molecular Formula | C21H14F3NO4S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C\c2ccc(/C=C/c3ccc(C(F)(F)F)cc3)cc2)C1=O |
| InChI | InChI=1S/C21H14F3NO4S/c22-21(23,24)16-9-7-14(8-10-16)2-1-13-3-5-15(6-4-13)11-17-19(28)25(12-18(26)27)20(29)30-17/h1-11H,12H2,(H,26,27)/b2-1+,17-11- |
| InChIKey | KKTXNFSGBYIOGC-LPZQWGDKSA-N |
| XLogP | 5.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|