C23H19N3O — CID 53330106
(3E,5E)-3,5-bis(1H-indol-3-ylmethylidene)piperidin-4-one (PubChem CID 53330106) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (3E,5E)-3,5-bis(1H-indol-3-ylmethylidene)piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis(1H-indol-3-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 53330106 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (3E,5E)-3,5-bis(1H-indol-3-ylmethylidene)piperidin-4-one |
| SMILES | O=C1/C(=C/c2c[nH]c3ccccc23)CNC/C1=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H19N3O/c27-23-17(9-15-13-25-21-7-3-1-5-19(15)21)11-24-12-18(23)10-16-14-26-22-8-4-2-6-20(16)22/h1-10,13-14,24-26H,11-12H2/b17-9+,18-10+ |
| InChIKey | MULHBMLXGYLZGG-BEQMOXJMSA-N |
| XLogP | 4.29 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|