C25H17F6N3O2 — CID 53330112
N-[4-(8-aminoquinolin-4-yl)oxy-2-methylphenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 53330112) has the molecular formula C25H17F6N3O2 and a molecular weight of 505.42 g/mol. Its IUPAC name is N-[4-(8-aminoquinolin-4-yl)oxy-2-methylphenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-(8-aminoquinolin-4-yl)oxy-2-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 53330112 |
| Molecular Formula | C25H17F6N3O2 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | N-[4-(8-aminoquinolin-4-yl)oxy-2-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1cc(Oc2ccnc3c(N)cccc23)ccc1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17F6N3O2/c1-13-9-17(36-21-7-8-33-22-18(21)3-2-4-19(22)32)5-6-20(13)34-23(35)14-10-15(24(26,27)28)12-16(11-14)25(29,30)31/h2-12H,32H2,1H3,(H,34,35) |
| InChIKey | PDTHDBFWOTYSLN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|