About (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate
(3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate (PubChem CID 53330773) has the molecular formula C21H25N3S2
and a molecular weight of 383.59 g/mol. Its IUPAC name is (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate.
Molecular Properties
| Compound Name | (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate |
| PubChem CID | 53330773 |
| Molecular Formula | C21H25N3S2 |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate |
| SMILES | CN(C)CCNC(=S)SCCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3S2/c1-24(2)15-14-23-20(25)26-16-13-21(17-22,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12H,13-16H2,1-2H3,(H,23,25) |
| InChIKey | NNKHHJZMHVPNBC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate?
The IUPAC name of (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate (CID 53330773) is (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate.
What is the SMILES notation for (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate?
The canonical SMILES for (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate is CN(C)CCNC(=S)SCCC(C#N)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate?
The InChIKey is NNKHHJZMHVPNBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3S2/c1-24(2)15-14-23-20(25)26-16-13-21(17-22,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12H,13-16H2,1-2H3,(H,23,25).
What are the key properties of (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate?
(3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate has a molecular weight of 383.59 g/mol, XLogP of 4.06, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-3,3-diphenylpropyl) N-[2-(dimethylamino)ethyl]carbamodithioate is sourced from PubChem (CID 53330773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).