C22H23Cl2N3O3S — CID 53331312
4,6-dichloro-10-[(4-methoxyphenyl)methyl]-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 53331312) has the molecular formula C22H23Cl2N3O3S and a molecular weight of 480.42 g/mol. Its IUPAC name is 4,6-dichloro-10-[(4-methoxyphenyl)methyl]-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 4,6-dichloro-10-[(4-methoxyphenyl)methyl]-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 53331312 |
| Molecular Formula | C22H23Cl2N3O3S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 4,6-dichloro-10-[(4-methoxyphenyl)methyl]-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1ccc(CN2C(=S)NC3c4cc(Cl)cc(Cl)c4OC2(C)C3C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O3S/c1-22-17(20(28)26(2)3)18(15-9-13(23)10-16(24)19(15)30-22)25-21(31)27(22)11-12-5-7-14(29-4)8-6-12/h5-10,17-18H,11H2,1-4H3,(H,25,31) |
| InChIKey | VOQRNMMKFIGOKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|