About 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one
1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 53331496) has the molecular formula C18H11BrF2N4O
and a molecular weight of 417.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 53331496 |
| Molecular Formula | C18H11BrF2N4O |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccc(Br)cc3)c2ncn1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H11BrF2N4O/c19-12-2-5-14(6-3-12)25-17-15(8-23-25)18(26)24(10-22-17)9-11-1-4-13(20)7-16(11)21/h1-8,10H,9H2 |
| InChIKey | DMVVUDMRZZUASZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one (CID 53331496) is 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one is O=c1c2cnn(-c3ccc(Br)cc3)c2ncn1Cc1ccc(F)cc1F.
What is the InChIKey of 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is DMVVUDMRZZUASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrF2N4O/c19-12-2-5-14(6-3-12)25-17-15(8-23-25)18(26)24(10-22-17)9-11-1-4-13(20)7-16(11)21/h1-8,10H,9H2.
What are the key properties of 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 417.21 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-5-[(2,4-difluorophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 53331496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).