C14H11ClN2O2S — CID 53331620
3-(4-chlorophenyl)-1-ethylthieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 53331620) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethylthieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-chlorophenyl)-1-ethylthieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53331620 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethylthieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)n(-c2ccc(Cl)cc2)c(=O)c2sccc21 |
| InChI | InChI=1S/C14H11ClN2O2S/c1-2-16-11-7-8-20-12(11)13(18)17(14(16)19)10-5-3-9(15)4-6-10/h3-8H,2H2,1H3 |
| InChIKey | AVJRTHHVSVIJKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |