About N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide
N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide (PubChem CID 5333276) has the molecular formula C13H16BrN3O2
and a molecular weight of 326.19 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide.
Molecular Properties
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide |
| PubChem CID | 5333276 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-3-17(4-2)13(19)12(18)16-15-9-10-5-7-11(14)8-6-10/h5-9H,3-4H2,1-2H3,(H,16,18)/b15-9+ |
| InChIKey | GEMWDSQWOWFCCP-OQLLNIDSSA-N |
| XLogP | 1.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide?
The IUPAC name of N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide (CID 5333276) is N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide.
What is the SMILES notation for N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide?
The canonical SMILES for N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide is CCN(CC)C(=O)C(=O)N/N=C/c1ccc(Br)cc1.
What is the InChIKey of N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide?
The InChIKey is GEMWDSQWOWFCCP-OQLLNIDSSA-N. The full InChI is InChI=1S/C13H16BrN3O2/c1-3-17(4-2)13(19)12(18)16-15-9-10-5-7-11(14)8-6-10/h5-9H,3-4H2,1-2H3,(H,16,18)/b15-9+.
What are the key properties of N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide?
N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide has a molecular weight of 326.19 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(4-bromophenyl)methylideneamino]-N',N'-diethyloxamide is sourced from PubChem (CID 5333276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).