C24H20FN5O2 — CID 53333641
4-[2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazin-4-yl]-1-(2-phenylethyl)piperazine-2,6-dione (PubChem CID 53333641) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazin-4-yl]-1-(2-phenylethyl)piperazine-2,6-dione.
| Compound Name | 4-[2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazin-4-yl]-1-(2-phenylethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 53333641 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-[2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazin-4-yl]-1-(2-phenylethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(c2nccn3nc(-c4ccc(F)cc4)cc23)CC(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C24H20FN5O2/c25-19-8-6-18(7-9-19)20-14-21-24(26-11-13-30(21)27-20)28-15-22(31)29(23(32)16-28)12-10-17-4-2-1-3-5-17/h1-9,11,13-14H,10,12,15-16H2 |
| InChIKey | FBJDQTJRVJCWIY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|