About 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine
2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine (PubChem CID 53333719) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 53333719 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine |
| SMILES | COc1ccc(-c2cc3c(N4CCCCC4)nccn3n2)cc1OC |
| InChI | InChI=1S/C19H22N4O2/c1-24-17-7-6-14(12-18(17)25-2)15-13-16-19(20-8-11-23(16)21-15)22-9-4-3-5-10-22/h6-8,11-13H,3-5,9-10H2,1-2H3 |
| InChIKey | PCYIUMWGTMYDMM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine (CID 53333719) is 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine is COc1ccc(-c2cc3c(N4CCCCC4)nccn3n2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine?
The InChIKey is PCYIUMWGTMYDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-24-17-7-6-14(12-18(17)25-2)15-13-16-19(20-8-11-23(16)21-15)22-9-4-3-5-10-22/h6-8,11-13H,3-5,9-10H2,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine?
2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine has a molecular weight of 338.41 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-4-piperidin-1-ylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 53333719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).