C22H28N4O3 — CID 53335650
N-cycloheptyl-4-(3-morpholin-4-ylpyrazin-2-yl)oxybenzamide (PubChem CID 53335650) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-cycloheptyl-4-(3-morpholin-4-ylpyrazin-2-yl)oxybenzamide.
| Compound Name | N-cycloheptyl-4-(3-morpholin-4-ylpyrazin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 53335650 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-cycloheptyl-4-(3-morpholin-4-ylpyrazin-2-yl)oxybenzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(Oc2nccnc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c27-21(25-18-5-3-1-2-4-6-18)17-7-9-19(10-8-17)29-22-20(23-11-12-24-22)26-13-15-28-16-14-26/h7-12,18H,1-6,13-16H2,(H,25,27) |
| InChIKey | AMXSBSCJBAWWAH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |