About N,N-dihexylbutanamide
N,N-dihexylbutanamide (PubChem CID 533361) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is N,N-dihexylbutanamide.
Molecular Properties
| Compound Name | N,N-dihexylbutanamide |
| PubChem CID | 533361 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N,N-dihexylbutanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCC |
| InChI | InChI=1S/C16H33NO/c1-4-7-9-11-14-17(16(18)13-6-3)15-12-10-8-5-2/h4-15H2,1-3H3 |
| InChIKey | JSQYTYFBRWYWQO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexylbutanamide?
The IUPAC name of N,N-dihexylbutanamide (CID 533361) is N,N-dihexylbutanamide.
What is the SMILES notation for N,N-dihexylbutanamide?
The canonical SMILES for N,N-dihexylbutanamide is CCCCCCN(CCCCCC)C(=O)CCC.
What is the InChIKey of N,N-dihexylbutanamide?
The InChIKey is JSQYTYFBRWYWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-4-7-9-11-14-17(16(18)13-6-3)15-12-10-8-5-2/h4-15H2,1-3H3.
What are the key properties of N,N-dihexylbutanamide?
N,N-dihexylbutanamide has a molecular weight of 255.45 g/mol, XLogP of 4.78, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexylbutanamide is sourced from PubChem (CID 533361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).