C23H30ClN5O3S — CID 53336787
3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]sulfonyl-1-ethyl-N,N-bis(prop-2-enyl)pyrazole-4-carboxamide (PubChem CID 53336787) has the molecular formula C23H30ClN5O3S and a molecular weight of 492.05 g/mol. Its IUPAC name is 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]sulfonyl-1-ethyl-N,N-bis(prop-2-enyl)pyrazole-4-carboxamide.
| Compound Name | 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]sulfonyl-1-ethyl-N,N-bis(prop-2-enyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53336787 |
| Molecular Formula | C23H30ClN5O3S |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]sulfonyl-1-ethyl-N,N-bis(prop-2-enyl)pyrazole-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cn(CC)nc1S(=O)(=O)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C23H30ClN5O3S/c1-5-10-27(11-6-2)23(30)20-17-28(7-3)25-22(20)33(31,32)29-14-12-26(13-15-29)21-16-19(24)9-8-18(21)4/h5-6,8-9,16-17H,1-2,7,10-15H2,3-4H3 |
| InChIKey | CABFLJLXYPSVBS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|