C13H12N2O2S — CID 53337258
5,5-dioxo-7,8,9,10-tetrahydropyrido[2,1-c][1,4]benzothiazine-6-carbonitrile (PubChem CID 53337258) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 5,5-dioxo-7,8,9,10-tetrahydropyrido[2,1-c][1,4]benzothiazine-6-carbonitrile.
| Compound Name | 5,5-dioxo-7,8,9,10-tetrahydropyrido[2,1-c][1,4]benzothiazine-6-carbonitrile |
|---|---|
| PubChem CID | 53337258 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5,5-dioxo-7,8,9,10-tetrahydropyrido[2,1-c][1,4]benzothiazine-6-carbonitrile |
| SMILES | N#CC1=C2CCCCN2c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H12N2O2S/c14-9-13-11-6-3-4-8-15(11)10-5-1-2-7-12(10)18(13,16)17/h1-2,5,7H,3-4,6,8H2 |
| InChIKey | CSOCVJKGVORYMX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |