C23H19N5 — CID 5333742
5,6-diphenyl-N-[(E)-1-phenylethylideneamino]-1,2,4-triazin-3-amine (PubChem CID 5333742) has the molecular formula C23H19N5 and a molecular weight of 365.44 g/mol. Its IUPAC name is 5,6-diphenyl-N-[(E)-1-phenylethylideneamino]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diphenyl-N-[(E)-1-phenylethylideneamino]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 5333742 |
| Molecular Formula | C23H19N5 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5,6-diphenyl-N-[(E)-1-phenylethylideneamino]-1,2,4-triazin-3-amine |
| SMILES | C/C(=N\Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H19N5/c1-17(18-11-5-2-6-12-18)25-27-23-24-21(19-13-7-3-8-14-19)22(26-28-23)20-15-9-4-10-16-20/h2-16H,1H3,(H,24,27,28)/b25-17+ |
| InChIKey | WEMTZIPIMSSTJY-KOEQRZSOSA-N |
| XLogP | 5.04 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|