About 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one
7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 53338131) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| PubChem CID | 53338131 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc2c(c1)Cc1c(nc(-c3ccccc3)[nH]c1=O)O2 |
| InChI | InChI=1S/C18H14N2O2/c1-11-7-8-15-13(9-11)10-14-17(21)19-16(20-18(14)22-15)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | PECVUCHCLGIUQV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The IUPAC name of 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (CID 53338131) is 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is Cc1ccc2c(c1)Cc1c(nc(-c3ccccc3)[nH]c1=O)O2.
What is the InChIKey of 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The InChIKey is PECVUCHCLGIUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-11-7-8-15-13(9-11)10-14-17(21)19-16(20-18(14)22-15)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,19,20,21).
What are the key properties of 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one has a molecular weight of 290.32 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 53338131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).