About (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one
(5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one (PubChem CID 53338877) has the molecular formula C11H11Br2N3O2
and a molecular weight of 377.04 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one.
Molecular Properties
| Compound Name | (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one |
| PubChem CID | 53338877 |
| Molecular Formula | C11H11Br2N3O2 |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one |
| SMILES | CN1/C(=C\c2cc(Br)c(O)c(Br)c2)C(=O)NC1N |
| InChI | InChI=1S/C11H11Br2N3O2/c1-16-8(10(18)15-11(16)14)4-5-2-6(12)9(17)7(13)3-5/h2-4,11,17H,14H2,1H3,(H,15,18)/b8-4- |
| InChIKey | ORUOSRDSZGLUBA-YWEYNIOJSA-N |
| XLogP | 1.56 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one?
The IUPAC name of (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one (CID 53338877) is (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one.
What is the SMILES notation for (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one?
The canonical SMILES for (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one is CN1/C(=C\c2cc(Br)c(O)c(Br)c2)C(=O)NC1N.
What is the InChIKey of (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one?
The InChIKey is ORUOSRDSZGLUBA-YWEYNIOJSA-N. The full InChI is InChI=1S/C11H11Br2N3O2/c1-16-8(10(18)15-11(16)14)4-5-2-6(12)9(17)7(13)3-5/h2-4,11,17H,14H2,1H3,(H,15,18)/b8-4-.
What are the key properties of (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one?
(5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one has a molecular weight of 377.04 g/mol, XLogP of 1.56, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-amino-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1-methylimidazolidin-4-one is sourced from PubChem (CID 53338877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).