About 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene
1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene (PubChem CID 53338920) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene.
Analyze 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The IUPAC name of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene (CID 53338920) is 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene.
What is the SMILES notation for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The canonical SMILES for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene is C1=CN2CCc3cccc(c32)C1.
What is the InChIKey of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
The InChIKey is NUOHRQXKJKPGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-3-9-5-2-7-12-8-6-10(4-1)11(9)12/h1-4,7H,5-6,8H2.
What are the key properties of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene?
1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene has a molecular weight of 157.22 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene is sourced from PubChem (CID 53338920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).