C43H61N5O13 — CID 53339363
N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-N'-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]butanediamide (PubChem CID 53339363) has the molecular formula C43H61N5O13 and a molecular weight of 855.98 g/mol. Its IUPAC name is N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-N'-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]butanediamide.
| Compound Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-N'-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]butanediamide |
|---|---|
| PubChem CID | 53339363 |
| Molecular Formula | C43H61N5O13 |
| Molecular Weight | 855.98 g/mol |
| Exact Mass | 855.43 |
| IUPAC Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-N'-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]butanediamide |
| SMILES | CCc1c(CNC(=O)CCC(=O)NCCCOCCOCCOCCCN)c(CC)c(CNC(=O)c2ccc(O)c(O)c2O)c(CC)c1CNC(=O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C43H61N5O13/c1-4-26-31(23-46-37(52)14-13-36(51)45-16-8-18-60-20-22-61-21-19-59-17-7-15-44)27(5-2)33(25-48-43(58)30-10-12-35(50)41(56)39(30)54)28(6-3)32(26)24-47-42(57)29-9-11-34(49)40(55)38(29)53/h9-12,49-50,53-56H,4-8,13-25,44H2,1-3H3,(H,45,51)(H,46,52)(H,47,57)(H,48,58) |
| InChIKey | CSAWLRITYUTKOF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 291.49 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|