C42H77NO2 — CID 53339367
3-[bis[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]piperidine (PubChem CID 53339367) has the molecular formula C42H77NO2 and a molecular weight of 628.08 g/mol. Its IUPAC name is 3-[bis[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]piperidine.
| Compound Name | 3-[bis[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]piperidine |
|---|---|
| PubChem CID | 53339367 |
| Molecular Formula | C42H77NO2 |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.60 |
| IUPAC Name | 3-[bis[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]piperidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(OCCCCCCCC/C=C\C/C=C\CCCCC)C1CCCNC1 |
| InChI | InChI=1S/C42H77NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-44-42(41-36-35-37-43-40-41)45-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,41-43H,3-10,15-16,21-40H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | KSTBLVHHJKWPCE-MAZCIEHSSA-N |
| XLogP | 12.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|