About 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide
2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 53339568) has the molecular formula C20H25F3N2O2
and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 53339568 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@H]1COCC[C@H]1N1CCCC1)c1ccc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C20H25F3N2O2/c21-20(22,23)14-5-6-15(16(11-14)13-3-4-13)19(26)24-17-12-27-10-7-18(17)25-8-1-2-9-25/h5-6,11,13,17-18H,1-4,7-10,12H2,(H,24,26)/t17-,18-/m1/s1 |
| InChIKey | OJYSFPGDNXYECI-QZTJIDSGSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide?
The IUPAC name of 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide (CID 53339568) is 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide is O=C(N[C@@H]1COCC[C@H]1N1CCCC1)c1ccc(C(F)(F)F)cc1C1CC1.
What is the InChIKey of 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide?
The InChIKey is OJYSFPGDNXYECI-QZTJIDSGSA-N. The full InChI is InChI=1S/C20H25F3N2O2/c21-20(22,23)14-5-6-15(16(11-14)13-3-4-13)19(26)24-17-12-27-10-7-18(17)25-8-1-2-9-25/h5-6,11,13,17-18H,1-4,7-10,12H2,(H,24,26)/t17-,18-/m1/s1.
What are the key properties of 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide?
2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide has a molecular weight of 382.43 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(3S,4R)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 53339568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).