C36H56FN3O5 — CID 53339605
(2S,4S,5S,7R)-5-amino-N'-[5-tert-butyl-2-(3-methoxypropoxy)phenyl]-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide (PubChem CID 53339605) has the molecular formula C36H56FN3O5 and a molecular weight of 629.86 g/mol. Its IUPAC name is (2S,4S,5S,7R)-5-amino-N'-[5-tert-butyl-2-(3-methoxypropoxy)phenyl]-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide.
| Compound Name | (2S,4S,5S,7R)-5-amino-N'-[5-tert-butyl-2-(3-methoxypropoxy)phenyl]-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
|---|---|
| PubChem CID | 53339605 |
| Molecular Formula | C36H56FN3O5 |
| Molecular Weight | 629.86 g/mol |
| Exact Mass | 629.42 |
| IUPAC Name | (2S,4S,5S,7R)-5-amino-N'-[5-tert-butyl-2-(3-methoxypropoxy)phenyl]-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
| SMILES | COCCCOc1ccc(C(C)(C)C)cc1NC(=O)C[C@@H](C[C@H](N)[C@@H](O)CC(C(=O)NCc1ccc(F)cc1)C(C)C)C(C)C |
| InChI | InChI=1S/C36H56FN3O5/c1-23(2)26(19-34(42)40-31-20-27(36(5,6)7)12-15-33(31)45-17-9-16-44-8)18-30(38)32(41)21-29(24(3)4)35(43)39-22-25-10-13-28(37)14-11-25/h10-15,20,23-24,26,29-30,32,41H,9,16-19,21-22,38H2,1-8H3,(H,39,43)(H,40,42)/t26-,29?,30+,32+/m1/s1 |
| InChIKey | BPAVRURTWJDWGV-GIHZZBLISA-N |
| XLogP | 6.20 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.86 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|